Content deleted Content added
png -> svg |
Gettinglit (talk | contribs) |
||
(47 intermediate revisions by 29 users not shown) | |||
Line 1:
{{short description|Chemical compound}}
{{Drugbox
|IUPAC_name = 1-(3,5-dimethoxy-4-propoxyphenyl)propan-2-amine▼
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477220361
| image = 3C-P_2d-skeletal.svg
| width = 200
| CAS_number= ▼
| PubChem= ▼
| C=14 | H=23 | N=1 | O=3▼
| smiles = COc1cc(CC(C)N)cc(OC)c1OCCC▼
}}▼
<!--Clinical data-->
| tradename =
| legal_DE = NpSG
| legal_UK = Class A
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
▲| CAS_number = 501700-11-4
▲| PubChem = 54929142
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21106238
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4KRX4MHV7L
<!--Chemical data-->
▲| C=14 | H=23 | N=1 | O=3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H23NO3/c1-5-6-18-14-12(16-3)8-11(7-10(2)15)9-13(14)17-4/h8-10H,5-7,15H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KKMCHCCXGKYEKJ-UHFFFAOYSA-N
▲}}
'''3C-P''' ('''α-Methyl-4-propoxy-3,5-dimethoxyphenethylamine''') is a [[psychedelic drug|psychedelic]] [[phenethylamine]]. It has structural and pharmacodynamic properties similar to the drugs [[mescaline]], [[proscaline]], and [[amphetamine]]. Little information exists on the human [[pharmacology]] of 3C-P, but a psychedelic dosage appears to be 20–40 mg,{{medcn|date=February 2018}} and is accompanied by [[stimulant]] and [[Psychedelic experience|psychedelic]] effects such as visual enhancement and distortion.{{medcn|date=February 2018}} It can be synthesized from [[syringaldehyde]] by reaction with [[n-Propyl iodide|''n''-propyl iodide]] followed by condensation with nitroethane and reduction.<ref>{{cite journal| vauthors = Trachsel D |title=Synthese von neuen (Phenylalkyl)aminen zur Untersuchung von Struktur-Aktivitätsbeziehungen, Mitteilung 1, Mescalin Derivate|journal=Helvetica Chimica Acta|date=September 2002|volume=85|issue=9|pages=3019–3026|doi=10.1002/1522-2675(200209)85:9<3019::AID-HLCA3019>3.0.CO;2-4}}</ref>
==See also==
*[[Phenethylamine]]
*[[3C-AL]]
*[[3C-MAL]]
==References==
{{Reflist}}
==External links==
*[http://www.erowid.org/chemicals/3cp/3cp.shtml Erowid 3C-P Information]
[[Category:Designer drugs]]
[[Category:Mescalines]]
[[Category:Substituted amphetamines]]
[[Category:Entheogens]]
[[Category:Drugs not assigned an ATC code]]
[[Category:O-methylated phenols]]
{{hallucinogen-stub}}
|
Latest revision as of 02:18, 27 June 2023
![]() | |
Legal status | |
---|---|
Legal status | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C14H23NO3 |
Molar mass | 253.342 g·mol−1 |
3D model (JSmol) | |
| |
| |
![]() ![]() |
3C-P (α-Methyl-4-propoxy-3,5-dimethoxyphenethylamine) is a psychedelic phenethylamine. It has structural and pharmacodynamic properties similar to the drugs mescaline, proscaline, and amphetamine. Little information exists on the human pharmacology of 3C-P, but a psychedelic dosage appears to be 20–40 mg,[medical citation needed] and is accompanied by stimulant and psychedelic effects such as visual enhancement and distortion.[medical citation needed] It can be synthesized from syringaldehyde by reaction with n-propyl iodide followed by condensation with nitroethane and reduction.[1]
See also
References
- ^ Trachsel D (September 2002). "Synthese von neuen (Phenylalkyl)aminen zur Untersuchung von Struktur-Aktivitätsbeziehungen, Mitteilung 1, Mescalin Derivate". Helvetica Chimica Acta. 85 (9): 3019–3026. doi:10.1002/1522-2675(200209)85:9<3019::AID-HLCA3019>3.0.CO;2-4.
External links