Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: {{cascite}} {{fdacite}} StdInChI StdInChIKey. |
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Ph |
||
Line 1: | Line 1: | ||
{{Drugbox |
{{Drugbox |
||
| verifiedrevid = |
| verifiedrevid = 401983686 |
||
| IUPAC_name = 3-(4-bromophenyl)- ''N'',''N''-dimethyl- 3-pyridin-2-yl-propan-1-amine |
| IUPAC_name = 3-(4-bromophenyl)- ''N'',''N''-dimethyl- 3-pyridin-2-yl-propan-1-amine |
||
| image = Dexbrompheniramine.svg |
| image = Dexbrompheniramine.svg |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 16068 |
| ChemSpiderID = 16068 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
Line 10: | Line 11: | ||
| smiles = Brc1ccc(cc1)[C@@H](c2ncccc2)CCN(C)C |
| smiles = Brc1ccc(cc1)[C@@H](c2ncccc2)CCN(C)C |
||
| InChIKey = ZDIGNSYAACHWNL-HNNXBMFYBC |
| InChIKey = ZDIGNSYAACHWNL-HNNXBMFYBC |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1 |
| StdInChI = 1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = ZDIGNSYAACHWNL-HNNXBMFYSA-N |
| StdInChIKey = ZDIGNSYAACHWNL-HNNXBMFYSA-N |
||
| CAS_number = 132-21-8 |
| CAS_number = 132-21-8 |
Revision as of 17:50, 12 December 2010
Clinical data | |
---|---|
ATC code | |
Legal status | |
Legal status | |
Pharmacokinetic data | |
Elimination half-life | 25 hours |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.004.595 |
Chemical and physical data | |
Formula | C16H19BrN2 |
Molar mass | 319.24 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Dexbrompheniramine (Drixoral) is an antihistamine with anticholinergic properties used to treat allergic conditions such as hay fever or urticaria. It is the pharmacologically active dextrorotatory isomer of brompheniramine. It is marketed under the name Drixoral in the US and Canada, which is a combination of dexbrompheniramine and pseudoephedrine.